CAS 1890953-50-0 is the registry number for 6-BROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine;hydrochloride (CAS 1890953-50-0) is a chemical compound with the molecular formula C6H6BrClN4 and a molecular weight of 249.49 g/mol. IUPAC name: 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine;hydrochloride. InChIKey: HPFVYHYKRMIAAF-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClN4 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine;hydrochloride |
| InChIKey | HPFVYHYKRMIAAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C=C1Br)N.Cl |
Computed by PubChem (NCBI)