CAS 18929-88-9 is the registry number for (2S,3S,4R,5R,6R)-2-(Bromomethyl)-4,5-dihydroxy-6-methoxytetrahydro-2H-pyran-3-yl benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3S,4R,5R,6R)-2-(bromomethyl)-4,5-dihydroxy-6-methoxyoxan-3-yl] benzoate (CAS 18929-88-9) is a chemical compound with the molecular formula C14H17BrO6 and a molecular weight of 361.18 g/mol. IUPAC name: [(2S,3S,4R,5R,6R)-2-(bromomethyl)-4,5-dihydroxy-6-methoxyoxan-3-yl] benzoate. InChIKey: VUWYKCUKVSNBJE-CBLPJQPBSA-N.
| Molecular formula | C14H17BrO6 |
|---|---|
| Molecular weight | 361.18 g/mol |
| IUPAC name | [(2S,3S,4R,5R,6R)-2-(bromomethyl)-4,5-dihydroxy-6-methoxyoxan-3-yl] benzoate |
| InChIKey | VUWYKCUKVSNBJE-CBLPJQPBSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CBr)OC(=O)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)