CAS 1895791-03-3 is the registry number for 3-Aminoadamantan-1-ol hydrate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 25g.
(5S,7R)-3-aminoadamantan-1-ol;hydrate (CAS 1895791-03-3) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: (5S,7R)-3-aminoadamantan-1-ol;hydrate. InChIKey: JAZOCBRQEJZXBJ-YFDATDCASA-N.
| Molecular formula | C10H19NO2 |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | (5S,7R)-3-aminoadamantan-1-ol;hydrate |
| InChIKey | JAZOCBRQEJZXBJ-YFDATDCASA-N |
| SMILES | C1[C@@H]2CC3(C[C@H]1CC(C2)(C3)O)N.O |
Computed by PubChem (NCBI)