Products 1898341-34-8

CAS 1898341-34-8 is the registry number for ethyl 2-(4-(benzyloxy)-3-fluorophenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-fluoro-4-phenylmethoxyphenyl)-2-oxoacetate (CAS 1898341-34-8) is a chemical compound with the molecular formula C17H15FO4 and a molecular weight of 302.30 g/mol. IUPAC name: ethyl 2-(3-fluoro-4-phenylmethoxyphenyl)-2-oxoacetate. InChIKey: SAYIEDURNXLHKH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15FO4
Molecular weight302.30 g/mol
IUPAC nameethyl 2-(3-fluoro-4-phenylmethoxyphenyl)-2-oxoacetate
InChIKeySAYIEDURNXLHKH-UHFFFAOYSA-N
SMILESCCOC(=O)C(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)F

Computed by PubChem (NCBI)