Products 1909293-59-9
CAS 1909293-59-9 is the registry number for (3S)-5-Methyl-3-({((3RS,4RS)-4-methylpyrrolidin-3-yl)formamido}methyl)hexanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S)-5-methyl-3-[[[(3S,4S)-4-methylpyrrolidine-3-carbonyl]amino]methyl]hexanoic acid (CAS 1909293-59-9) is a chemical compound with the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. IUPAC name: (3S)-5-methyl-3-[[[(3S,4S)-4-methylpyrrolidine-3-carbonyl]amino]methyl]hexanoic acid. InChIKey: CRKZNIRNWJFKKF-GRYCIOLGSA-N.
| Molecular formula | C14H26N2O3 |
|---|---|
| Molecular weight | 270.37 g/mol |
| IUPAC name | (3S)-5-methyl-3-[[[(3S,4S)-4-methylpyrrolidine-3-carbonyl]amino]methyl]hexanoic acid |
| InChIKey | CRKZNIRNWJFKKF-GRYCIOLGSA-N |
| SMILES | C[C@@H]1CNC[C@H]1C(=O)NC[C@@H](CC(C)C)CC(=O)O |
Computed by PubChem (NCBI)