Products 1909296-38-3
CAS 1909296-38-3 is the registry number for 1-(1,2-Dimethyl-1H-indol-3-yl)-2,2-difluoroethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1-(1,2-dimethylindol-3-yl)-2,2-difluoroethanone (CAS 1909296-38-3) is a chemical compound with the molecular formula C12H11F2NO and a molecular weight of 223.22 g/mol. IUPAC name: 1-(1,2-dimethylindol-3-yl)-2,2-difluoroethanone. InChIKey: DHJXMUBUSHEVLM-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 1-(1,2-dimethylindol-3-yl)-2,2-difluoroethanone |
| InChIKey | DHJXMUBUSHEVLM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C)C(=O)C(F)F |
Computed by PubChem (NCBI)