CAS 1918113-29-7 is the registry number for Adenosine Impurity 32. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3R,5R)-4,4-dibromo-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 1918113-29-7) is a chemical compound with the molecular formula C10H12Br2N6O3 and a molecular weight of 424.05 g/mol. IUPAC name: (2R,3R,5R)-4,4-dibromo-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: JDVMQYXXSATBRQ-TWOGKDBTSA-N.
| Molecular formula | C10H12Br2N6O3 |
|---|---|
| Molecular weight | 424.05 g/mol |
| IUPAC name | (2R,3R,5R)-4,4-dibromo-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | JDVMQYXXSATBRQ-TWOGKDBTSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3C([C@@H]([C@H](O3)CO)O)(Br)Br)N)N |
Computed by PubChem (NCBI)