Products 192809-26-0
CAS 192809-26-0 is the registry number for IR5790. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-tert-butyl-3-(2,4-dichloro-5-prop-2-ynoxyphenyl)-1,3,4-thiadiazol-2-one (CAS 192809-26-0) is a chemical compound with the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.3 g/mol. IUPAC name: 5-tert-butyl-3-(2,4-dichloro-5-prop-2-ynoxyphenyl)-1,3,4-thiadiazol-2-one. InChIKey: NJZXYZBBMXJJCK-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2N2O2S |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | 5-tert-butyl-3-(2,4-dichloro-5-prop-2-ynoxyphenyl)-1,3,4-thiadiazol-2-one |
| InChIKey | NJZXYZBBMXJJCK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=O)S1)C2=CC(=C(C=C2Cl)Cl)OCC#C |
Computed by PubChem (NCBI)