CAS 1931999-55-1 is the registry number for methyl (1R,3S)-3-hydroxy-2,2-dimethyl-cyclobutanecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-methyl (1R,3S)-3-hydroxy-2,2-dimethylcyclobutane-1-carboxylate (CAS 1931999-55-1) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: trans-methyl (1R,3S)-3-hydroxy-2,2-dimethylcyclobutane-1-carboxylate. InChIKey: CXBVPPWGWUOBMX-WDSKDSINSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | trans-methyl (1R,3S)-3-hydroxy-2,2-dimethylcyclobutane-1-carboxylate |
| InChIKey | CXBVPPWGWUOBMX-WDSKDSINSA-N |
| SMILES | CC1([C@@H](C[C@@H]1O)C(=O)OC)C |
Computed by PubChem (NCBI)