CAS 1932146-99-0 is the registry number for (4aS,7aR)-tert-Butyl hexahydropyrrolo[3,4-b][1,4]oxazine-4(4aH)-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-4-carboxylate (CAS 1932146-99-0) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-4-carboxylate. InChIKey: YLMNCYATSGIUDS-DTWKUNHWSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-4-carboxylate |
| InChIKey | YLMNCYATSGIUDS-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H]2[C@@H]1CNC2 |
Computed by PubChem (NCBI)