CAS 1935712-23-4 is the registry number for 2,4-Dichloro-N-(2-chloro-6-methylphenyl)-5-pyrimidinemethanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-N-[(2,4-dichloropyrimidin-5-yl)methyl]-6-methylaniline (CAS 1935712-23-4) is a chemical compound with the molecular formula C12H10Cl3N3 and a molecular weight of 302.6 g/mol. IUPAC name: 2-chloro-N-[(2,4-dichloropyrimidin-5-yl)methyl]-6-methylaniline. InChIKey: GBKYIGWKEZDCNI-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl3N3 |
|---|---|
| Molecular weight | 302.6 g/mol |
| IUPAC name | 2-chloro-N-[(2,4-dichloropyrimidin-5-yl)methyl]-6-methylaniline |
| InChIKey | GBKYIGWKEZDCNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)NCC2=CN=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)