CAS 195259-19-9 appears in our catalog under these names: Lomefloxacin Impurity 8, 7-((2-Aminopropyl)amino)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic Acid Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
7-(2-aminopropylamino)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (CAS 195259-19-9) is a chemical compound with the molecular formula C15H18FN3O3 and a molecular weight of 307.32 g/mol. IUPAC name: 7-(2-aminopropylamino)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: AGLYCCLYFGJOTO-UHFFFAOYSA-N.
| Molecular formula | C15H18FN3O3 |
|---|---|
| Molecular weight | 307.32 g/mol |
| IUPAC name | 7-(2-aminopropylamino)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| InChIKey | AGLYCCLYFGJOTO-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)NCC(C)N)F)C(=O)O |
Computed by PubChem (NCBI)