CAS 1954363-09-7 is the registry number for Methyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylate (CAS 1954363-09-7) is a chemical compound with the molecular formula C16H19BO4S and a molecular weight of 318.2 g/mol. IUPAC name: methyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylate. InChIKey: ZDRBIAZDRFOGGD-UHFFFAOYSA-N.
| Molecular formula | C16H19BO4S |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | methyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylate |
| InChIKey | ZDRBIAZDRFOGGD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=C(S3)C(=O)OC |
Computed by PubChem (NCBI)