CAS 1955546-94-7 is the registry number for 4-[1,1′-Biphenyl]-4-yl-6-(3′-chloro[1,1′-biphenyl]-3-yl)-2-phenylpyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[3-(3-chlorophenyl)phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine (CAS 1955546-94-7) is a chemical compound with the molecular formula C34H23ClN2 and a molecular weight of 495.0 g/mol. IUPAC name: 4-[3-(3-chlorophenyl)phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine. InChIKey: PDSPUSNNZCIXNB-UHFFFAOYSA-N.
| Molecular formula | C34H23ClN2 |
|---|---|
| Molecular weight | 495.0 g/mol |
| IUPAC name | 4-[3-(3-chlorophenyl)phenyl]-2-phenyl-6-(4-phenylphenyl)pyrimidine |
| InChIKey | PDSPUSNNZCIXNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC(=NC(=N3)C4=CC=CC=C4)C5=CC=CC(=C5)C6=CC(=CC=C6)Cl |
Computed by PubChem (NCBI)