CAS 1956303-48-2 is the registry number for Ceftolozane Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(Z)-[2-amino-1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (CAS 1956303-48-2) is a chemical compound with the molecular formula C8H11N5O4S and a molecular weight of 273.27 g/mol. IUPAC name: 2-[(Z)-[2-amino-1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid. InChIKey: HFXPJVOXPNLBIS-KGVSQERTSA-N.
| Molecular formula | C8H11N5O4S |
|---|---|
| Molecular weight | 273.27 g/mol |
| IUPAC name | 2-[(Z)-[2-amino-1-(5-amino-1,2,4-thiadiazol-3-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| InChIKey | HFXPJVOXPNLBIS-KGVSQERTSA-N |
| SMILES | CC(C)(C(=O)O)O/N=C(/C1=NSC(=N1)N)\C(=O)N |
Computed by PubChem (NCBI)