CAS 1958012-17-3 is the registry number for 7-Chloro-4-ethynyl-1,4-dihydro-1-[(4-methylphenyl)sulfonyl]-2H-3,1-benzoxazin-2-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 10mg.
7-chloro-4-ethynyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one (CAS 1958012-17-3) is a chemical compound with the molecular formula C17H12ClNO4S and a molecular weight of 361.8 g/mol. IUPAC name: 7-chloro-4-ethynyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one. InChIKey: ROESLTSDTZXVGF-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO4S |
|---|---|
| Molecular weight | 361.8 g/mol |
| IUPAC name | 7-chloro-4-ethynyl-1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one |
| InChIKey | ROESLTSDTZXVGF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3=C(C=CC(=C3)Cl)C(OC2=O)C#C |
Computed by PubChem (NCBI)