CAS 1961231-34-4 is the registry number for 2'-Hydroxy-[1,1':4',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-(3,5-dicarboxyphenyl)-3-hydroxyphenyl]benzene-1,3-dicarboxylic acid (CAS 1961231-34-4) is a chemical compound with the molecular formula C22H14O9 and a molecular weight of 422.3 g/mol. IUPAC name: 5-[4-(3,5-dicarboxyphenyl)-3-hydroxyphenyl]benzene-1,3-dicarboxylic acid. InChIKey: MJTMYWQJQFQQFQ-UHFFFAOYSA-N.
| Molecular formula | C22H14O9 |
|---|---|
| Molecular weight | 422.3 g/mol |
| IUPAC name | 5-[4-(3,5-dicarboxyphenyl)-3-hydroxyphenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | MJTMYWQJQFQQFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)