Products 1962025-90-6
CAS 1962025-90-6 is the registry number for 1-(4-Bromo-2,5-difluorophenyl)dihydropyrimidine-2,4(1H,3H)-dione, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(4-bromo-2,5-difluorophenyl)-1,3-diazinane-2,4-dione (CAS 1962025-90-6) is a chemical compound with the molecular formula C10H7BrF2N2O2 and a molecular weight of 305.08 g/mol. IUPAC name: 1-(4-bromo-2,5-difluorophenyl)-1,3-diazinane-2,4-dione. InChIKey: IPJQTXWMALUSOE-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF2N2O2 |
|---|---|
| Molecular weight | 305.08 g/mol |
| IUPAC name | 1-(4-bromo-2,5-difluorophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | IPJQTXWMALUSOE-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)