Products 197501-15-8
CAS 197501-15-8 appears in our catalog under these names: [1,1':4',1'':4'',1'''-Quaterphenyl]-2,2''',5,5'''-tetracarboxylic acid, 98%, [1,1':4',1'':4'',1'''-Quaterphenyl]-2,2''',5,5'''-tetracarboxylic acid, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
2-[4-[4-(2,5-dicarboxyphenyl)phenyl]phenyl]terephthalic acid (CAS 197501-15-8) is a chemical compound with the molecular formula C28H18O8 and a molecular weight of 482.4 g/mol. IUPAC name: 2-[4-[4-(2,5-dicarboxyphenyl)phenyl]phenyl]terephthalic acid. InChIKey: TVRHYDATPDZULV-UHFFFAOYSA-N.
| Molecular formula | C28H18O8 |
|---|---|
| Molecular weight | 482.4 g/mol |
| IUPAC name | 2-[4-[4-(2,5-dicarboxyphenyl)phenyl]phenyl]terephthalic acid |
| InChIKey | TVRHYDATPDZULV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=C(C=CC(=C3)C(=O)O)C(=O)O)C4=C(C=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)