Products 1975179-77-1
CAS 1975179-77-1 is the registry number for 2'-Methoxy-[1,1':3',1''-terphenyl]-4,4'',5'-tricarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-bis(4-carboxyphenyl)-4-methoxybenzoic acid (CAS 1975179-77-1) is a chemical compound with the molecular formula C22H16O7 and a molecular weight of 392.4 g/mol. IUPAC name: 3,5-bis(4-carboxyphenyl)-4-methoxybenzoic acid. InChIKey: VVFVQNWEJLSAMA-UHFFFAOYSA-N.
| Molecular formula | C22H16O7 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 3,5-bis(4-carboxyphenyl)-4-methoxybenzoic acid |
| InChIKey | VVFVQNWEJLSAMA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C2=CC=C(C=C2)C(=O)O)C(=O)O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)