CAS 1978305-26-8 appears in our catalog under these names: Posaconazole Impurity 85, Posaconazole Impurity 164. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,5R)-5-(4-fluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol (CAS 1978305-26-8) is a chemical compound with the molecular formula C14H16FN3O2 and a molecular weight of 277.29 g/mol. IUPAC name: [(3R,5R)-5-(4-fluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol. InChIKey: SSXYWVPZKZMMLF-RISCZKNCSA-N.
| Molecular formula | C14H16FN3O2 |
|---|---|
| Molecular weight | 277.29 g/mol |
| IUPAC name | [(3R,5R)-5-(4-fluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol |
| InChIKey | SSXYWVPZKZMMLF-RISCZKNCSA-N |
| SMILES | C1[C@@H](CO[C@@]1(CN2C=NC=N2)C3=CC=C(C=C3)F)CO |
Computed by PubChem (NCBI)