Products 1980075-70-4
CAS 1980075-70-4 appears in our catalog under these names: 2-Aminodipyrido[1,2-a:3',2'-d]imidazole dihydrochloride, 98%, 2-Aminodipyrido(1,2-a:3',2’-d)imidazole Dihydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-4-amine;dihydrochloride (CAS 1980075-70-4) is a chemical compound with the molecular formula C10H10Cl2N4 and a molecular weight of 257.12 g/mol. IUPAC name: 1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-4-amine;dihydrochloride. InChIKey: LQFGYIJQTGVJPS-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N4 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-4-amine;dihydrochloride |
| InChIKey | LQFGYIJQTGVJPS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC3=C(N2C=C1)N=C(C=C3)N.Cl.Cl |
Computed by PubChem (NCBI)