CAS 1983111-08-5 is the registry number for rel-1-(tert-Butyl) 2-methyl (2S,5R)-5-(4-(trifluoromethyl)phenyl)pyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 2-O-methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-1,2-dicarboxylate (CAS 1983111-08-5) is a chemical compound with the molecular formula C18H22F3NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-1,2-dicarboxylate. InChIKey: AEZJZVRAQVZXIQ-KGLIPLIRSA-N.
| Molecular formula | C18H22F3NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-1,2-dicarboxylate |
| InChIKey | AEZJZVRAQVZXIQ-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CC[C@H]1C(=O)OC)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)