Products 2001023-60-3
CAS 2001023-60-3 is the registry number for Methyl 3-(benzo[d]thiazol-2-yl)-4-hydroxybenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Methyl 3-(1,3-benzothiazol-2-yl)-4-hydroxybenzoate (CAS 2001023-60-3) is a chemical compound with the molecular formula C15H11NO3S and a molecular weight of 285.3 g/mol. IUPAC name: methyl 3-(1,3-benzothiazol-2-yl)-4-hydroxybenzoate. InChIKey: ATEAFVNEJRSDHE-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | methyl 3-(1,3-benzothiazol-2-yl)-4-hydroxybenzoate |
| InChIKey | ATEAFVNEJRSDHE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)O)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)