Products 200948-89-6

CAS 200948-89-6 is the registry number for 1-Methyl (1S,2S)-1,2-cyclohexanedicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Trans-(1S,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid (CAS 200948-89-6) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: trans-(1S,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: BOVPVRGRPPYECC-BQBZGAKWSA-N.

Identity
Molecular formulaC9H14O4
Molecular weight186.20 g/mol
IUPAC nametrans-(1S,2S)-2-methoxycarbonylcyclohexane-1-carboxylic acid
InChIKeyBOVPVRGRPPYECC-BQBZGAKWSA-N
SMILESCOC(=O)[C@H]1CCCC[C@@H]1C(=O)O

Computed by PubChem (NCBI)