Products 201489-40-9
CAS 201489-40-9 is the registry number for Di-iso-propyl-d14 Ether, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
1,1,1,2,3,3,3-heptadeuterio-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)propane (CAS 201489-40-9) is a chemical compound with the molecular formula C6H14O and a molecular weight of 116.26 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuterio-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)propane. InChIKey: ZAFNJMIOTHYJRJ-ZVEBFXSZSA-N.
| Molecular formula | C6H14O |
|---|---|
| Molecular weight | 116.26 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuterio-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)propane |
| InChIKey | ZAFNJMIOTHYJRJ-ZVEBFXSZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)