Products 2026591-80-8
CAS 2026591-80-8 is the registry number for BB1-acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]diazenyl]benzoic acid (CAS 2026591-80-8) is a chemical compound with the molecular formula C28H29N5O2 and a molecular weight of 467.6 g/mol. IUPAC name: 4-[[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]diazenyl]benzoic acid. InChIKey: UINYEYRRODHJQN-UHFFFAOYSA-N.
| Molecular formula | C28H29N5O2 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | 4-[[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]diazenyl]benzoic acid |
| InChIKey | UINYEYRRODHJQN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=CN(C2=NN=NC3=CC=C(C=C3)C(=O)O)C4=C(C=C(C=C4C)C)C)C |
Computed by PubChem (NCBI)