Products 2029818-90-2
CAS 2029818-90-2 is the registry number for 1-(2-chloro-6-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2-chloro-6-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-one (CAS 2029818-90-2) is a chemical compound with the molecular formula C9H3ClF6O and a molecular weight of 276.56 g/mol. IUPAC name: 1-(2-chloro-6-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-one. InChIKey: QWRAWRBPWCBERX-UHFFFAOYSA-N.
| Molecular formula | C9H3ClF6O |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 1-(2-chloro-6-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| InChIKey | QWRAWRBPWCBERX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)