Products 2034154-94-2
CAS 2034154-94-2 is the registry number for 3-(2-Ethoxyethyl)-5,6-dimethylbenzo[d]thiazol-2(3H)-imine 4-methylbenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid (CAS 2034154-94-2) is a chemical compound with the molecular formula C20H26N2O4S2 and a molecular weight of 422.6 g/mol. IUPAC name: 3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid. InChIKey: XLIMUPPMEMJABN-UHFFFAOYSA-N.
| Molecular formula | C20H26N2O4S2 |
|---|---|
| Molecular weight | 422.6 g/mol |
| IUPAC name | 3-(2-ethoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-imine;4-methylbenzenesulfonic acid |
| InChIKey | XLIMUPPMEMJABN-UHFFFAOYSA-N |
| SMILES | CCOCCN1C2=C(C=C(C(=C2)C)C)SC1=N.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)