Products 2035090-53-8
CAS 2035090-53-8 is the registry number for 10-(2-Chloro-4-pyrimidinyl)-6,7,8,9-tetrahydropyrido[1,2-a]indole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
10-(2-chloropyrimidin-4-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indole (CAS 2035090-53-8) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 10-(2-chloropyrimidin-4-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indole. InChIKey: VGZVMXPGIADANZ-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 10-(2-chloropyrimidin-4-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indole |
| InChIKey | VGZVMXPGIADANZ-UHFFFAOYSA-N |
| SMILES | C1CCN2C(=C(C3=CC=CC=C32)C4=NC(=NC=C4)Cl)C1 |
Computed by PubChem (NCBI)