CAS 2036323-79-0 is the registry number for H-L-Phe(4-Azido-PrTz)-OH*TFA. Offered by: Iris Biotech. Available pack sizes: 25mg, 100mg.
(2S)-2-amino-3-[4-(6-butyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid (CAS 2036323-79-0) is a chemical compound with the molecular formula C15H19N5O2 and a molecular weight of 301.34 g/mol. IUPAC name: (2S)-2-amino-3-[4-(6-butyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid. InChIKey: FRBUDUHSPUNFGH-LBPRGKRZSA-N.
| Molecular formula | C15H19N5O2 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(6-butyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid |
| InChIKey | FRBUDUHSPUNFGH-LBPRGKRZSA-N |
| SMILES | CCCCC1=NN=C(N=N1)C2=CC=C(C=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)