Products 2055776-17-3
CAS 2055776-17-3 appears in our catalog under these names: PF–06445974, PF-06445974, 98.59%, PF-06445974, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 50 mg, 10mM/1mL, 10 mg, 25 mg, 5 mg.
4-(11-cyclopropyl-10-oxo-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-8-yl)-2-fluorobenzonitrile (CAS 2055776-17-3) is a chemical compound with the molecular formula C20H15FN4O and a molecular weight of 346.4 g/mol. IUPAC name: 4-(11-cyclopropyl-10-oxo-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-8-yl)-2-fluorobenzonitrile. InChIKey: YWTCDMZVTLNYLN-UHFFFAOYSA-N.
| Molecular formula | C20H15FN4O |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 4-(11-cyclopropyl-10-oxo-1,6,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-8-yl)-2-fluorobenzonitrile |
| InChIKey | YWTCDMZVTLNYLN-UHFFFAOYSA-N |
| SMILES | C1CC1N2CCN3C4=C(C(=C3C2=O)C5=CC(=C(C=C5)C#N)F)N=CC=C4 |
Computed by PubChem (NCBI)