Products 2056912-14-0
CAS 2056912-14-0 is the registry number for 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[b]naphtho[1,2-d]furan, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g.
4,4,5,5-tetramethyl-2-naphtho[2,1-b][1]benzofuran-3-yl-1,3,2-dioxaborolane (CAS 2056912-14-0) is a chemical compound with the molecular formula C22H21BO3 and a molecular weight of 344.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-naphtho[2,1-b][1]benzofuran-3-yl-1,3,2-dioxaborolane. InChIKey: BNJJGXUNLQFANA-UHFFFAOYSA-N.
| Molecular formula | C22H21BO3 |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-naphtho[2,1-b][1]benzofuran-3-yl-1,3,2-dioxaborolane |
| InChIKey | BNJJGXUNLQFANA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=C(C=C3)OC5=CC=CC=C54 |
Computed by PubChem (NCBI)