CAS 2061963-89-9 is the registry number for (4-Fluoro-3-methyl-5-(trifluoromethyl)phenyl)hydrazine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride (CAS 2061963-89-9) is a chemical compound with the molecular formula C8H9ClF4N2 and a molecular weight of 244.62 g/mol. IUPAC name: [4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride. InChIKey: ZVDKPJXQPSYJSY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF4N2 |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | [4-fluoro-3-methyl-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | ZVDKPJXQPSYJSY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)