CAS 2068-80-6 appears in our catalog under these names: L–Aspartic acid magnesium salt, L-Aspartic acid hemimagnesium salt dihydrate, H-Asp-OH·Mg 98%, H-Asp-OH.Mg, 98%, 98%, H-Asp-OH.Mg, 98.0%. Offered by: GLPBio, Chemat, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 500g, 100g, 25g, 1000g, 1kg, 500 g, 1 kg, 100 g.
CAS 2068-80-6 identifies a chemical compound with the molecular formula C4H7MgNO4 and a molecular weight of 157.41 g/mol. InChIKey: ISYHFARMUCCYDZ-DKWTVANSSA-N.
| Molecular formula | C4H7MgNO4 |
|---|---|
| Molecular weight | 157.41 g/mol |
| InChIKey | ISYHFARMUCCYDZ-DKWTVANSSA-N |
| SMILES | C([C@@H](C(=O)O)N)C(=O)O.[Mg] |
Computed by PubChem (NCBI)