Products 2070018-29-8
CAS 2070018-29-8 appears in our catalog under these names: AGN 205327, AGN 205327, 98+%. Offered by: TargetMol, Chemat, MedChemExpress, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 5mg, 10mg, Get quote.
2-[(E)-N-hydroxy-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]-1H-indole-5-carboxylic acid (CAS 2070018-29-8) is a chemical compound with the molecular formula C24H26N2O3 and a molecular weight of 390.5 g/mol. IUPAC name: 2-[(E)-N-hydroxy-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]-1H-indole-5-carboxylic acid. InChIKey: CTYNDNYSDMIEPV-YYADALCUSA-N.
| Molecular formula | C24H26N2O3 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 2-[(E)-N-hydroxy-C-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbonimidoyl]-1H-indole-5-carboxylic acid |
| InChIKey | CTYNDNYSDMIEPV-YYADALCUSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)/C(=N\O)/C3=CC4=C(N3)C=CC(=C4)C(=O)O)(C)C)C |
Computed by PubChem (NCBI)