CAS 207279-37-6 is the registry number for Ethyl(1R,2R)-2-(4-Bromophenyl)cyclopropanecarboxylate, >95%, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Trans-ethyl (1R,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylate (CAS 207279-37-6) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylate. InChIKey: RAFFPNRMOQNLAA-WDEREUQCSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-(4-bromophenyl)cyclopropane-1-carboxylate |
| InChIKey | RAFFPNRMOQNLAA-WDEREUQCSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)