Products 207389-21-7
CAS 207389-21-7 is the registry number for 2,7-Di(3-buten-1-yl)fluorene, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2,7-bis(but-3-enyl)-9H-fluorene (CAS 207389-21-7) is a chemical compound with the molecular formula C21H22 and a molecular weight of 274.4 g/mol. IUPAC name: 2,7-bis(but-3-enyl)-9H-fluorene. InChIKey: UWAMUAVCHSGLDJ-UHFFFAOYSA-N.
| Molecular formula | C21H22 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 2,7-bis(but-3-enyl)-9H-fluorene |
| InChIKey | UWAMUAVCHSGLDJ-UHFFFAOYSA-N |
| SMILES | C=CCCC1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)CCC=C |
Computed by PubChem (NCBI)