Products 2089056-09-5
CAS 2089056-09-5 is the registry number for A-395N. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(3S,4R)-1-benzyl-N,N-dimethyl-4-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrrolidin-3-amine (CAS 2089056-09-5) is a chemical compound with the molecular formula C24H34N4O2S and a molecular weight of 442.6 g/mol. IUPAC name: (3S,4R)-1-benzyl-N,N-dimethyl-4-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrrolidin-3-amine. InChIKey: VEABDKBNQNHHCB-BJKOFHAPSA-N.
| Molecular formula | C24H34N4O2S |
|---|---|
| Molecular weight | 442.6 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-N,N-dimethyl-4-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrrolidin-3-amine |
| InChIKey | VEABDKBNQNHHCB-BJKOFHAPSA-N |
| SMILES | CN(C)[C@@H]1CN(C[C@H]1C2=CC=C(C=C2)N3CCN(CC3)S(=O)(=O)C)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)