Products 2091862-62-1
CAS 2091862-62-1 is the registry number for 2-Bromo-4-(difluoromethoxy)-6-methoxyaniline, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2-bromo-4-(difluoromethoxy)-6-methoxyaniline (CAS 2091862-62-1) is a chemical compound with the molecular formula C8H8BrF2NO2 and a molecular weight of 268.06 g/mol. IUPAC name: 2-bromo-4-(difluoromethoxy)-6-methoxyaniline. InChIKey: HPGLOHMIKZDSOC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrF2NO2 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 2-bromo-4-(difluoromethoxy)-6-methoxyaniline |
| InChIKey | HPGLOHMIKZDSOC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)OC(F)F)Br)N |
Computed by PubChem (NCBI)