CAS 2092028-48-1 appears in our catalog under these names: (E)-2'-(Phenyldiazenyl)-[1,1':4',1''-terphenyl]-4,4''-diamine, 98%, 98%, (E)-2'-(Phenyldiazenyl)-[1,1':4',1''-terphenyl]-4,4''-diamine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(4-aminophenyl)-3-phenyldiazenylphenyl]aniline (CAS 2092028-48-1) is a chemical compound with the molecular formula C24H20N4 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[4-(4-aminophenyl)-3-phenyldiazenylphenyl]aniline. InChIKey: SZEIRRWHIDAMTC-UHFFFAOYSA-N.
| Molecular formula | C24H20N4 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[4-(4-aminophenyl)-3-phenyldiazenylphenyl]aniline |
| InChIKey | SZEIRRWHIDAMTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC(=C2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)