CAS 2094735-34-7 appears in our catalog under these names: Voriconazole Impurity 56, Voriconazole Impurity 23 Bromide. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-amino-1,2,4-triazol-4-ium-1-yl)-1-(2-fluorophenyl)ethanone bromide (CAS 2094735-34-7) is a chemical compound with the molecular formula C10H10BrFN4O and a molecular weight of 301.11 g/mol. IUPAC name: 2-(4-amino-1,2,4-triazol-4-ium-1-yl)-1-(2-fluorophenyl)ethanone bromide. InChIKey: JIUQOTLGERPDDO-UHFFFAOYSA-M.
| Molecular formula | C10H10BrFN4O |
|---|---|
| Molecular weight | 301.11 g/mol |
| IUPAC name | 2-(4-amino-1,2,4-triazol-4-ium-1-yl)-1-(2-fluorophenyl)ethanone bromide |
| InChIKey | JIUQOTLGERPDDO-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)CN2C=[N+](C=N2)N)F.[Br-] |
Computed by PubChem (NCBI)