Products 2096338-07-5
CAS 2096338-07-5 is the registry number for 4-(3-Furfuryl)aminomethylphenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-(furan-3-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (CAS 2096338-07-5) is a chemical compound with the molecular formula C18H24BNO3 and a molecular weight of 313.2 g/mol. IUPAC name: N-(furan-3-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine. InChIKey: BYCASIAUQMVOJS-UHFFFAOYSA-N.
| Molecular formula | C18H24BNO3 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | N-(furan-3-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| InChIKey | BYCASIAUQMVOJS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CNCC3=COC=C3 |
Computed by PubChem (NCBI)