Products 2096978-48-0
CAS 2096978-48-0 is the registry number for N-[5-(1,1-Dimethylethyl)-2-methylphenyl]-2,4-dimethylbenzenamine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N-(5-tert-butyl-2-methylphenyl)-2,4-dimethylaniline (CAS 2096978-48-0) is a chemical compound with the molecular formula C19H25N and a molecular weight of 267.4 g/mol. IUPAC name: N-(5-tert-butyl-2-methylphenyl)-2,4-dimethylaniline. InChIKey: APPOJNOTDCYTIX-UHFFFAOYSA-N.
| Molecular formula | C19H25N |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | N-(5-tert-butyl-2-methylphenyl)-2,4-dimethylaniline |
| InChIKey | APPOJNOTDCYTIX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=C(C=CC(=C2)C(C)(C)C)C)C |
Computed by PubChem (NCBI)