CAS 2098444-97-2 appears in our catalog under these names: Netarsudil Impurity 4, Netarsudil Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2098444-97-2) is a chemical compound with the molecular formula C24H29NO6 and a molecular weight of 427.5 g/mol. IUPAC name: (2R)-2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GZKGVCBKFIAZRP-FQEVSTJZSA-N.
| Molecular formula | C24H29NO6 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (2R)-2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GZKGVCBKFIAZRP-FQEVSTJZSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OCC2=CC=C(C=C2)[C@H](CNC(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)