Products 2101947-36-6
CAS 2101947-36-6 is the registry number for Nintedanib Impurity 58. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3E)-3-[(4-methylpiperazin-1-yl)-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate (CAS 2101947-36-6) is a chemical compound with the molecular formula C22H23N3O3 and a molecular weight of 377.4 g/mol. IUPAC name: methyl (3E)-3-[(4-methylpiperazin-1-yl)-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate. InChIKey: NNCNQBMEHFXKIB-FMQUCBEESA-N.
| Molecular formula | C22H23N3O3 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | methyl (3E)-3-[(4-methylpiperazin-1-yl)-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
| InChIKey | NNCNQBMEHFXKIB-FMQUCBEESA-N |
| SMILES | CN1CCN(CC1)/C(=C/2\C3=C(C=C(C=C3)C(=O)OC)NC2=O)/C4=CC=CC=C4 |
Computed by PubChem (NCBI)