Products 2102409-07-2
CAS 2102409-07-2 is the registry number for 4-Bromo-2-(tert-butyl)-5-fluorophenol, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-bromo-2-tert-butyl-5-fluorophenol (CAS 2102409-07-2) is a chemical compound with the molecular formula C10H12BrFO and a molecular weight of 247.10 g/mol. IUPAC name: 4-bromo-2-tert-butyl-5-fluorophenol. InChIKey: GLQSBZQRBPNQJH-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFO |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 4-bromo-2-tert-butyl-5-fluorophenol |
| InChIKey | GLQSBZQRBPNQJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1O)F)Br |
Computed by PubChem (NCBI)