CAS 2103352-55-0 is the registry number for Methyl 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-indole-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Methyl 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-6-carboxylate (CAS 2103352-55-0) is a chemical compound with the molecular formula C17H22BNO4 and a molecular weight of 315.2 g/mol. IUPAC name: methyl 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-6-carboxylate. InChIKey: SSDFIXWUQMPNPG-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO4 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | methyl 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-6-carboxylate |
| InChIKey | SSDFIXWUQMPNPG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2C=CN3C)C(=O)OC |
Computed by PubChem (NCBI)