CAS 2125995-27-7 is the registry number for Bupivacaine Impurity 12 HCl. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-1-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;hydrochloride (CAS 2125995-27-7) is a chemical compound with the molecular formula C18H29ClN2O and a molecular weight of 324.9 g/mol. IUPAC name: (2S)-1-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;hydrochloride. InChIKey: CDVXMFGBHLTXOM-RCPFAERMSA-N.
| Molecular formula | C18H29ClN2O |
|---|---|
| Molecular weight | 324.9 g/mol |
| IUPAC name | (2S)-1-[(2R)-butan-2-yl]-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;hydrochloride |
| InChIKey | CDVXMFGBHLTXOM-RCPFAERMSA-N |
| SMILES | CC[C@@H](C)N1CCCC[C@H]1C(=O)NC2=C(C=CC=C2C)C.Cl |
Computed by PubChem (NCBI)