Products 2126158-01-6
CAS 2126158-01-6 is the registry number for rac-tert-Butyl (3R,4S)-3-amino-4-(4-cyclopropyl-1H-1,2,3-triazol-1-yl)cyclopentane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-amino-4-(4-cyclopropyltriazol-1-yl)cyclopentane-1-carboxylate (CAS 2126158-01-6) is a chemical compound with the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. IUPAC name: tert-butyl 3-amino-4-(4-cyclopropyltriazol-1-yl)cyclopentane-1-carboxylate. InChIKey: SGNUQEAGCSURPZ-UHFFFAOYSA-N.
| Molecular formula | C15H24N4O2 |
|---|---|
| Molecular weight | 292.38 g/mol |
| IUPAC name | tert-butyl 3-amino-4-(4-cyclopropyltriazol-1-yl)cyclopentane-1-carboxylate |
| InChIKey | SGNUQEAGCSURPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C(C1)N2C=C(N=N2)C3CC3)N |
Computed by PubChem (NCBI)